From bidentate H-spirophosporane ligand to tridentate phosphonate ligand in palladium chemistry

[Display omitted] •Reactivity of bidentate H-spirophosphorane complex was investigated.•Hydrolysis of bidentate phosphorane palladium complex yields the new tridentate one.•The structure, physico-chemical properties of palladium complex were studied. Recrystallization of a palladium compound bearing bidentate H-spirophosporane [PdCl{P(OCH2CHi-PrNH)OCH2CHi-PrNH2}] from methanol in air atmosphere, gave rise to the palladium complex with tridentate NPN ligand [PdCl{P(O)(OCH2CHi-PrNH2)2}]. The structures of the complex and H-spirophosphorane ligand HP(OCH2CHi-PrNH)2 were determined using spectroscopic methods as well as by single-crystal X-ray diffraction.