Magnetic disk and manufacturing method thereof

A magnetic disk of is provided, the magnetic disk having at least a magnetic layer, a carbon protective layer, and a lubrication layer sequentially provided on a substrate. In an embodiment, the lubrication layer a film formed by a lubricant having a perfluoropolyether compound A having a perfluorop...

Ausführliche Beschreibung

Gespeichert in:
Bibliographische Detailangaben
Hauptverfasser: Itoh, Kae, Shimokawa, Koichi, Hamakubo, Katsushi
Format: Patent
Sprache:eng
Schlagworte:
Online-Zugang:Volltext bestellen
Tags: Tag hinzufügen
Keine Tags, Fügen Sie den ersten Tag hinzu!
Beschreibung
Zusammenfassung:A magnetic disk of is provided, the magnetic disk having at least a magnetic layer, a carbon protective layer, and a lubrication layer sequentially provided on a substrate. In an embodiment, the lubrication layer a film formed by a lubricant having a perfluoropolyether compound A having a perfluoropolyether main chain in the structure and also having a hydroxyl group at the end and a compound C obtained from a reaction between a compound B expressed by: [Chemical formula 1] CF3(-O-C2F4)m-(O-CF2)n-OCF3 [m and n in the formula are natural numbers.] and aluminum oxide.