MAGNETIC DISK AND MANUFACTURING METHOD THEREOF
A magnetic disk of is provided, the magnetic disk having at least a magnetic layer, a carbon protective layer, and a lubrication layer sequentially provided on a substrate. In an embodiment, the lubrication layer a film formed by a lubricant having a perfluoropolyether compound A having a perfluorop...
Gespeichert in:
Hauptverfasser: | , , |
---|---|
Format: | Patent |
Sprache: | eng |
Schlagworte: | |
Online-Zugang: | Volltext bestellen |
Tags: |
Tag hinzufügen
Keine Tags, Fügen Sie den ersten Tag hinzu!
|
Zusammenfassung: | A magnetic disk of is provided, the magnetic disk having at least a magnetic layer, a carbon protective layer, and a lubrication layer sequentially provided on a substrate. In an embodiment, the lubrication layer a film formed by a lubricant having a perfluoropolyether compound A having a perfluoropolyether main chain in the structure and also having a hydroxyl group at the end and a compound C obtained from a reaction between a compound B expressed by: [Chemical formula 1] CF3(-O-C2F4)m-(O-CF2)n-OCF3 [m and n in the formula are natural numbers.] and aluminum oxide. |
---|