V족 원소의 무기 실릴 및 폴리실릴 유도체 및 이의 합성 방법 및 증착을 위한 이의 사용 방법
V족 원소-함유 전구체 및 이의 합성 방법 및 필름 증착에서의 이의 사용 방법이 개시된다. 전구체는 (SiR3)3-mA(SiaH2a+1)m, (SiR3)3-n-pA(SiaH2a+1)n(SibH2b+1)p 또는 A(SiaH2a+1)(SibH2b+1)(SicH2c+1)이며, 여기서, a = 1 내지 6이고; b = 1 내지 6이고; c = 1 내지 6이고; a ≠ b ≠ c이고; m = 1 내지 3이고; n = 1 내지 2이고, p = 1 내지 2이고, n + p = 2 내지 3이고; A = As, P, Sb, Bi이고; R은 C1 내...
Gespeichert in:
Hauptverfasser: | , , |
---|---|
Format: | Patent |
Sprache: | kor |
Schlagworte: | |
Online-Zugang: | Volltext bestellen |
Tags: |
Tag hinzufügen
Keine Tags, Fügen Sie den ersten Tag hinzu!
|
Zusammenfassung: | V족 원소-함유 전구체 및 이의 합성 방법 및 필름 증착에서의 이의 사용 방법이 개시된다. 전구체는 (SiR3)3-mA(SiaH2a+1)m, (SiR3)3-n-pA(SiaH2a+1)n(SibH2b+1)p 또는 A(SiaH2a+1)(SibH2b+1)(SicH2c+1)이며, 여기서, a = 1 내지 6이고; b = 1 내지 6이고; c = 1 내지 6이고; a ≠ b ≠ c이고; m = 1 내지 3이고; n = 1 내지 2이고, p = 1 내지 2이고, n + p = 2 내지 3이고; A = As, P, Sb, Bi이고; R은 C1 내지 C10, 선형, 분지형 또는 환형 알킬, 알케닐, 알키닐 기로부터 선택된다. 합성 방법에는 할로(폴리)실란(들)과 A의 트리스(트리알킬실릴) 유도체 사이의 1단계, 2단계 또는 3단계 반응(들) 또는 2가지 또는 3가지의 할로(폴리)실란의 혼합물과 A의 트리스(트리알킬실릴) 유도체 사이의 원-포트(one-pot) 혼합 반응이 포함된다. 증착 방법에는 CVD, PECVD, ALD, PEALD, 유동성 CVD, HW-CVD, 에피택시(Epitaxy) 등이 포함된다.
Disclosed are Group V element-containing precursors and methods of synthesizing the same and using the same on film depositions. The precursors are (SiR3)3- mA(SiaH2a+1)m, (SiR3)3- n-pA(SiaH2a+1)n(SibH2b+1)p or A(SiaH2a+1)(SibH2b+1)(SicH2c+1) wherein a 1 to 6; b = 1 to 6: c =1 to 6: a≠ b≠ c; m = 1 to 3; n = 1 to 2, p = 1 to 2, n + p = 2 to 3; A = As, P, Sb, Bi; and R is selected from a C1 to C10 linear, branched or cyclic alkyl, alkenyl, alky ny I group. The synthesis methods include one-step, two-step or three-step reaction(s) between halo(poly)silane(s) and a tris(trialkylsilyl) derivative of A or a one-pot mixing reaction between a mixture of two or three halo(poly)silanes and the tris(trialkylsilyl) derivative of A. The deposition methods include CVD, PECVD, ALD, PEALD, flowable CVD, HW-CVD, Epitaxy, or the like. |
---|