Novel route to the unsymmetrical dialkyl complex CpW(NO)(CH2SiMe3)(CH2CPh3) and formation of metallacycles by thermolysis of CpW(NO)(CH2SiMe3)(CH2CR2Ph) (R = Me, Ph)

Gespeichert in:

Bibliographische Detailangaben
Veröffentlicht in:	Organometallics 1993-11, Vol.12 (11), p.4572-4579
Hauptverfasser:	Brunet, Nathalie, Debad, Jeff D, Legzdins, Peter, Trotter, James, Veltheer, John E, Yee, Vivien C
Format:	Artikel
Sprache:	eng
Schlagworte:	Chemistry Condensed matter: structure, mechanical and thermal properties Exact sciences and technology Organic chemistry Organic compounds Organometalloidal and organometallic compounds Physics Preparations and properties Structure of solids and liquids crystallography Structure of specific crystalline solids Transition metals derivatives
Online-Zugang:	Volltext
Tags:	Tag hinzufügen Keine Tags, Fügen Sie den ersten Tag hinzu!